Difference between revisions of "CPD-452"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * smiles: ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(...")
(Created page with "Category:metabolite == Metabolite CPD-452 == * common-name: ** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol == Reaction(s) known to consume the com...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOTETRAOSE ==
+
== Metabolite CPD-452 ==
 
* common-name:
 
* common-name:
** maltotetraose
+
** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol
* smiles:
 
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
 
* inchi-key:
 
** luewuzlmquobsb-ayqjavfrsa-n
 
* molecular-weight:
 
** 666.583
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5182]]
+
* [[2.4.1.198-RXN]]
 +
* [[3.1.1.69-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYMALTOPHOSPHORYL-RXN]]
+
* [[2.4.1.198-RXN]]
* [[RXN-14281]]
 
* [[RXN-14284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotetraose}}
+
{{#set: common-name=a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol}}
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
 
{{#set: molecular-weight=666.583}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-452

  • common-name:
    • a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality