Difference between revisions of "CPD-611"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1422 == * common-name: ** dipalmitoyl phosphatidate * smiles: ** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o * i...")
(Created page with "Category:metabolite == Metabolite CPD-611 == * common-name: ** thiamine triphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=n...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1422 ==
+
== Metabolite CPD-611 ==
 
* common-name:
 
* common-name:
** dipalmitoyl phosphatidate
+
** thiamine triphosphate
 
* smiles:
 
* smiles:
** cccccccccccccccc(=o)occ(cop(=o)([o-])[o-])oc(ccccccccccccccc)=o
+
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
 
* inchi-key:
 
* inchi-key:
** porpenfltbbhsg-mgbgtmovsa-l
+
** iwlrowzyzpnofc-uhfffaoysa-k
 
* molecular-weight:
 
* molecular-weight:
** 646.883
+
** 501.26
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSPHATIDATE-PHOSPHATASE-RXN-CPD0-1422/WATER//CPD66-34/Pi.29.]]
+
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-6705]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dipalmitoyl phosphatidate}}
+
{{#set: common-name=thiamine triphosphate}}
{{#set: inchi-key=inchikey=porpenfltbbhsg-mgbgtmovsa-l}}
+
{{#set: inchi-key=inchikey=iwlrowzyzpnofc-uhfffaoysa-k}}
{{#set: molecular-weight=646.883}}
+
{{#set: molecular-weight=501.26}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-611

  • common-name:
    • thiamine triphosphate
  • smiles:
    • cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
  • inchi-key:
    • iwlrowzyzpnofc-uhfffaoysa-k
  • molecular-weight:
    • 501.26

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality