Difference between revisions of "13-HYDROPEROXYOCTADECA-911-DIENOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Type-1-transmemberane-domains == * common-name: ** type-1 transmembrane proteins == Reaction(s) known to consume the compound == * 3.4....") |
(Created page with "Category:metabolite == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == * common-name: ** (13s)-hpode * smiles: ** cccccc(c=cc=ccccccccc(=o)[o-])oo * inchi-key: ** jdsrhv...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (13s)-hpode |
| + | * smiles: | ||
| + | ** cccccc(c=cc=ccccccccc(=o)[o-])oo | ||
| + | * inchi-key: | ||
| + | ** jdsrhvwsamtssn-irqzeampsa-m | ||
| + | * molecular-weight: | ||
| + | ** 311.44 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[LIPOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(13s)-hpode}} |
| + | {{#set: inchi-key=inchikey=jdsrhvwsamtssn-irqzeampsa-m}} | ||
| + | {{#set: molecular-weight=311.44}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 13-HYDROPEROXYOCTADECA-911-DIENOATE
- common-name:
- (13s)-hpode
- smiles:
- cccccc(c=cc=ccccccccc(=o)[o-])oo
- inchi-key:
- jdsrhvwsamtssn-irqzeampsa-m
- molecular-weight:
- 311.44
