Difference between revisions of "Enones"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14443 == * common-name: ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate * smiles: ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) * inchi-k...") |
(Created page with "Category:metabolite == Metabolite Enones == * common-name: ** an enone == Reaction(s) known to consume the compound == * RXN-12267 == Reaction(s) known to produce the...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Enones == |
* common-name: | * common-name: | ||
| − | ** | + | ** an enone |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12267]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12267]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an enone}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Enones
- common-name:
- an enone
