Difference between revisions of "Beta-D-glucosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-GLUTAMYL-P == * common-name: ** n-acetylglutamyl-phosphate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-] * inchi-key:...")
(Created page with "Category:metabolite == Metabolite Beta-D-glucosides == * common-name: ** a β-d glucoside == Reaction(s) known to consume the compound == * 3.2.1.21-RXN == Reactio...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ACETYL-GLUTAMYL-P ==
+
== Metabolite Beta-D-glucosides ==
 
* common-name:
 
* common-name:
** n-acetylglutamyl-phosphate
+
** a β-d glucoside
* smiles:
 
** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
 
* inchi-key:
 
** fcvihfvsxhopsw-yfkpbyrvsa-k
 
* molecular-weight:
 
** 266.124
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[3.2.1.21-RXN]]
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLGLUTKIN-RXN]]
 
* [[AGK]]
 
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetylglutamyl-phosphate}}
+
{{#set: common-name=a β-d glucoside}}
{{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}}
 
{{#set: molecular-weight=266.124}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Beta-D-glucosides

  • common-name:
    • a β-d glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality