Difference between revisions of "CPD0-2015"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c([n+])c(=o)nc1(c(o)c(o)c(cop...")
(Created page with "Category:metabolite == Metabolite CPD0-2015 == * common-name: ** n-acetyl-l-methionine * smiles: ** cc(=o)nc(ccsc)c([o-])=o * inchi-key: ** xuypxlnmdzirqh-lurjtmiesa-m * m...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE ==
+
== Metabolite CPD0-2015 ==
 
* common-name:
 
* common-name:
** n1-(5-phospho-β-d-ribosyl)glycinamide
+
** n-acetyl-l-methionine
 
* smiles:
 
* smiles:
** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
+
** cc(=o)nc(ccsc)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** obqmlsfouzuiob-shuuezrqsa-m
+
** xuypxlnmdzirqh-lurjtmiesa-m
 
* molecular-weight:
 
* molecular-weight:
** 285.17
+
** 190.237
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FPGFTh]]
 
* [[GART-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FGFTh]]
+
* [[RXN-17892]]
* [[FPGFTh]]
+
* [[RXN-17893]]
* [[GART-RXN]]
+
* [[RXN0-6948]]
* [[GLYRIBONUCSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}}
+
{{#set: common-name=n-acetyl-l-methionine}}
{{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}}
+
{{#set: inchi-key=inchikey=xuypxlnmdzirqh-lurjtmiesa-m}}
{{#set: molecular-weight=285.17}}
+
{{#set: molecular-weight=190.237}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD0-2015

  • common-name:
    • n-acetyl-l-methionine
  • smiles:
    • cc(=o)nc(ccsc)c([o-])=o
  • inchi-key:
    • xuypxlnmdzirqh-lurjtmiesa-m
  • molecular-weight:
    • 190.237

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality