Difference between revisions of "CPD-14596"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite yW-86 == * common-name: ** 7-[(3s)-3-amino-3-carboxypropyl]-4-demethylwyosine37 in trnaphe == Reaction(s) known to consume the compound =...") |
(Created page with "Category:metabolite == Metabolite CPD-14596 == * common-name: ** neolinustatin * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c * inchi-key: ** wosy...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14596 == |
* common-name: | * common-name: | ||
| − | ** | + | ** neolinustatin |
| + | * smiles: | ||
| + | ** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c | ||
| + | * inchi-key: | ||
| + | ** wosyvgndrybqcq-bargltkpsa-n | ||
| + | * molecular-weight: | ||
| + | ** 423.416 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13603]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=neolinustatin}} |
| + | {{#set: inchi-key=inchikey=wosyvgndrybqcq-bargltkpsa-n}} | ||
| + | {{#set: molecular-weight=423.416}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-14596
- common-name:
- neolinustatin
- smiles:
- ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
- inchi-key:
- wosyvgndrybqcq-bargltkpsa-n
- molecular-weight:
- 423.416
