Difference between revisions of "Reduced-NrdH-Proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OROTIDINE-5-PHOSPHATE == * common-name: ** orotidine 5'-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)n...")
(Created page with "Category:metabolite == Metabolite Reduced-NrdH-Proteins == * common-name: ** a reduced nrdh glutaredoxin-like protein == Reaction(s) known to consume the compound == * R...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OROTIDINE-5-PHOSPHATE ==
+
== Metabolite Reduced-NrdH-Proteins ==
 
* common-name:
 
* common-name:
** orotidine 5'-phosphate
+
** a reduced nrdh glutaredoxin-like protein
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c(c(=o)[o-])=cc(=o)nc(=o)2))
 
* inchi-key:
 
** kyobshfobaofbf-xvfcmesisa-k
 
* molecular-weight:
 
** 365.17
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[OROPRIBTRANS-RXN]]
+
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
* [[OROTPDECARB-RXN]]
+
* [[RXN0-722]]
* [[ORPDC]]
+
* [[RXN0-747]]
* [[ORPRT]]
+
* [[RXN0-748]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[OROPRIBTRANS-RXN]]
 
* [[ORPRT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=orotidine 5'-phosphate}}
+
{{#set: common-name=a reduced nrdh glutaredoxin-like protein}}
{{#set: inchi-key=inchikey=kyobshfobaofbf-xvfcmesisa-k}}
 
{{#set: molecular-weight=365.17}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite Reduced-NrdH-Proteins

  • common-name:
    • a reduced nrdh glutaredoxin-like protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality