Difference between revisions of "CPD-12676"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine2605 == * common-name: ** uridine2605 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11836 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-12676 == * common-name: ** 5'-chloro-5'-deoxyadenosine * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl * inchi-key: **...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12676 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-chloro-5'-deoxyadenosine |
| + | * smiles: | ||
| + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl | ||
| + | * inchi-key: | ||
| + | ** iysnpomtkfzdhz-kqynxxcusa-n | ||
| + | * molecular-weight: | ||
| + | ** 285.689 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11715]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5'-chloro-5'-deoxyadenosine}} |
| + | {{#set: inchi-key=inchikey=iysnpomtkfzdhz-kqynxxcusa-n}} | ||
| + | {{#set: molecular-weight=285.689}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-12676
- common-name:
- 5'-chloro-5'-deoxyadenosine
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))cl
- inchi-key:
- iysnpomtkfzdhz-kqynxxcusa-n
- molecular-weight:
- 285.689
