Difference between revisions of "D-6-P-GLUCONO-DELTA-LACTONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Hypoxanthine-In-tRNAs-34s == * common-name: ** a hypoxanthine 34 in trnas == Reaction(s) known to consume the compound == * RXN-13997...")
(Created page with "Category:metabolite == Metabolite D-6-P-GLUCONO-DELTA-LACTONE == * common-name: ** 6-phospho d-glucono-1,5-lactone * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Hypoxanthine-In-tRNAs-34s ==
+
== Metabolite D-6-P-GLUCONO-DELTA-LACTONE ==
 
* common-name:
 
* common-name:
** a hypoxanthine 34 in trnas
+
** 6-phospho d-glucono-1,5-lactone
 +
* smiles:
 +
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
 +
* inchi-key:
 +
** ijojivndfqsgab-sqougzdysa-l
 +
* molecular-weight:
 +
** 256.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13997]]
+
* [[6PGLUCONOLACT-RXN]]
 +
* [[RXN-14819]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13997]]
+
* [[G6PADH]]
 +
* [[G6PADHh]]
 +
* [[G6PBDH]]
 +
* [[G6PBDHh]]
 +
* [[GLU6PDEHYDROG-RXN]]
 +
* [[RXN-14819]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a hypoxanthine 34 in trnas}}
+
{{#set: common-name=6-phospho d-glucono-1,5-lactone}}
 +
{{#set: inchi-key=inchikey=ijojivndfqsgab-sqougzdysa-l}}
 +
{{#set: molecular-weight=256.105}}

Latest revision as of 11:16, 18 March 2021

Metabolite D-6-P-GLUCONO-DELTA-LACTONE

  • common-name:
    • 6-phospho d-glucono-1,5-lactone
  • smiles:
    • c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(=o)o1)
  • inchi-key:
    • ijojivndfqsgab-sqougzdysa-l
  • molecular-weight:
    • 256.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality