Difference between revisions of "CPD-1084"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD-1084 == * common-name: ** perillyl aldehyde == Reaction(s) known to consume the compound == * RXN-14280 == Reaction(s) known to p...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-1084 == |
* common-name: | * common-name: | ||
| − | ** | + | ** perillyl aldehyde |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14280]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=perillyl aldehyde}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-1084
- common-name:
- perillyl aldehyde
