Difference between revisions of "CPD-13758"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NOREPINEPHRINE == * common-name: ** (r)-noradrenaline * smiles: ** c1(c=c(o)c(=cc=1c(c[n+])o)o) * inchi-key: ** sflshlfxelfnjz-qmmmgpobsa...") |
(Created page with "Category:metabolite == Metabolite CPD-13758 == * common-name: ** 3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-oxopropanoyl-coa * smiles: ** cc(c...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13758 == |
* common-name: | * common-name: | ||
− | ** ( | + | ** 3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-oxopropanoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c(o)ccc2(c)(c(=o)cc[ch]12)))cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ogahroymeoborv-xongilkksa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 999.769 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12750]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-oxopropanoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ogahroymeoborv-xongilkksa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=999.769}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-13758
- common-name:
- 3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-oxopropanoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c(o)ccc2(c)(c(=o)cc[ch]12)))cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-]
- inchi-key:
- ogahroymeoborv-xongilkksa-j
- molecular-weight:
- 999.769
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(3as,4s,5r,7as)-5-hydroxy-7a-methyl-1-oxo-octahydro-1h-inden-4-yl]-3-oxopropanoyl-coa" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.