Difference between revisions of "L-EPINEPHRINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14950 == * common-name: ** 3-o-methylkaempferol * smiles: ** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3)) * inchi-key: ** v...") |
(Created page with "Category:metabolite == Metabolite L-EPINEPHRINE == * common-name: ** (r)-adrenaline * smiles: ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) * inchi-key: ** uctwmzqnuqwslp-vifpvbqesa-o...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-EPINEPHRINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-adrenaline |
* smiles: | * smiles: | ||
| − | ** | + | ** c[n+]cc(o)c1(c=cc(=c(c=1)o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uctwmzqnuqwslp-vifpvbqesa-o |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 184.214 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10908]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-adrenaline}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uctwmzqnuqwslp-vifpvbqesa-o}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=184.214}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite L-EPINEPHRINE
- common-name:
- (r)-adrenaline
- smiles:
- c[n+]cc(o)c1(c=cc(=c(c=1)o)o)
- inchi-key:
- uctwmzqnuqwslp-vifpvbqesa-o
- molecular-weight:
- 184.214
