Difference between revisions of "SS-Oligoribonucleotides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-596 == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c * inchi-key: ** ydgmgexadbmomj-lurj...") |
(Created page with "Category:metabolite == Metabolite SS-Oligoribonucleotides == * common-name: ** a single-stranded oligoribonucleotide == Reaction(s) known to consume the compound == == Rea...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite SS-Oligoribonucleotides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a single-stranded oligoribonucleotide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.26.11-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a single-stranded oligoribonucleotide}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite SS-Oligoribonucleotides
- common-name:
- a single-stranded oligoribonucleotide
