Difference between revisions of "CPD-7222"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1028 == * common-name: ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)o...")
(Created page with "Category:metabolite == Metabolite CPD-7222 == * common-name: ** (2e)-dodec-2-enoyl-coa * smiles: ** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-1028 ==
+
== Metabolite CPD-7222 ==
 
* common-name:
 
* common-name:
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
** (2e)-dodec-2-enoyl-coa
 
* smiles:
 
* smiles:
** cc(=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c
+
** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
 
* inchi-key:
 
* inchi-key:
** oinneunvozhbox-kwbdajkesa-k
+
** irfyvbulxzmede-xcfippspsa-j
 
* molecular-weight:
 
* molecular-weight:
** 447.424
+
** 943.792
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH5]]
 +
* [[ECOAH5h]]
 +
* [[ECOAH5m]]
 +
* [[RXN-14262]]
 +
* [[RXN-7931]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5180]]
+
* [[ACOA120OR]]
 +
* [[ECOAH5]]
 +
* [[ECOAH5h]]
 +
* [[ECOAH5m]]
 +
* [[RXN-14262]]
 +
* [[RXN-7931]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
{{#set: common-name=(2e)-dodec-2-enoyl-coa}}
{{#set: inchi-key=inchikey=oinneunvozhbox-kwbdajkesa-k}}
+
{{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}}
{{#set: molecular-weight=447.424}}
+
{{#set: molecular-weight=943.792}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-7222

  • common-name:
    • (2e)-dodec-2-enoyl-coa
  • smiles:
    • cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
  • inchi-key:
    • irfyvbulxzmede-xcfippspsa-j
  • molecular-weight:
    • 943.792

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality