Difference between revisions of "3-P-SERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-SERINE == * common-name: ** a 3-o-sn-phosphatidyl-l-serine == Reaction(s) known to consume the compound == * PHOSPHASE...")
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * smiles: ** c(op([o-])([o-])=o)c([n+])c(=o)[o-] * inchi-key: ** bzqfbwgglxlepq-reohcl...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-1-PHOSPHATIDYL-SERINE ==
+
== Metabolite 3-P-SERINE ==
 
* common-name:
 
* common-name:
** a 3-o-sn-phosphatidyl-l-serine
+
** 3-phospho-l-serine
 +
* smiles:
 +
** c(op([o-])([o-])=o)c([n+])c(=o)[o-]
 +
* inchi-key:
 +
** bzqfbwgglxlepq-reohclbhsa-l
 +
* molecular-weight:
 +
** 183.057
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSPHASERSYN-RXN]]
+
* [[PSERTRANSAM-RXN]]
* [[RXN-1382]]
+
* [[RXN0-5114]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSPHASERSYN-RXN]]
+
* [[PSERTRANSAM-RXN]]
* [[RXN-1382]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-o-sn-phosphatidyl-l-serine}}
+
{{#set: common-name=3-phospho-l-serine}}
 +
{{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}}
 +
{{#set: molecular-weight=183.057}}

Latest revision as of 11:17, 18 March 2021

Metabolite 3-P-SERINE

  • common-name:
    • 3-phospho-l-serine
  • smiles:
    • c(op([o-])([o-])=o)c([n+])c(=o)[o-]
  • inchi-key:
    • bzqfbwgglxlepq-reohclbhsa-l
  • molecular-weight:
    • 183.057

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality