Difference between revisions of "GLC"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Heparan-sulfate-D-GlcNS == * common-name: ** a [heparan sulfate]-α-d-n-sulfoglucosamine == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GLC == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-glucopyranose |
| + | * smiles: | ||
| + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) | ||
| + | * inchi-key: | ||
| + | ** wqzgkkkjijffok-vfuothlcsa-n | ||
| + | * molecular-weight: | ||
| + | ** 180.157 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ALDOSE-1-EPIMERASE-RXN]] |
| − | * [[ | + | * [[GLUCISOM-RXN-GLC//CPD-15382.15.]] |
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.106-RXN]] |
| + | * [[ALDOSE-1-EPIMERASE-RXN]] | ||
| + | * [[GLUCISOM-RXN-GLC//CPD-15382.15.]] | ||
| + | * [[TREHALA-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-glucopyranose}} |
| + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-vfuothlcsa-n}} | ||
| + | {{#set: molecular-weight=180.157}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite GLC
- common-name:
- β-d-glucopyranose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-vfuothlcsa-n
- molecular-weight:
- 180.157
