Difference between revisions of "TETRADECANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...")
(Created page with "Category:metabolite == Metabolite TETRADECANOYL-COA == * common-name: ** myristoyl-coa * smiles: ** cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op(...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRIDOXINE-5P ==
+
== Metabolite TETRADECANOYL-COA ==
 
* common-name:
 
* common-name:
** pyridoxine 5'-phosphate
+
** myristoyl-coa
 
* smiles:
 
* smiles:
** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
+
** cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** whomfkwhiqzthy-uhfffaoysa-l
+
** duafkxofbzqtqe-qsgbvpjfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 247.144
+
** 973.861
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PNPOXI-RXN]]
+
* [[2.3.1.97-RXN]]
* [[RXN-14181]]
+
* [[ACACT7]]
 +
* [[ACACT7h]]
 +
* [[ACACT7m]]
 +
* [[ACOA140OR]]
 +
* [[RXN-17021]]
 +
* [[RXN-17023]]
 +
* [[RXN-9626]]
 +
* [[RXN3O-8214]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PNKIN-RXN]]
+
* [[ACACT7]]
 +
* [[RXN3O-8214]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyridoxine 5'-phosphate}}
+
{{#set: common-name=myristoyl-coa}}
{{#set: inchi-key=inchikey=whomfkwhiqzthy-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=duafkxofbzqtqe-qsgbvpjfsa-j}}
{{#set: molecular-weight=247.144}}
+
{{#set: molecular-weight=973.861}}

Latest revision as of 11:17, 18 March 2021

Metabolite TETRADECANOYL-COA

  • common-name:
    • myristoyl-coa
  • smiles:
    • cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • duafkxofbzqtqe-qsgbvpjfsa-j
  • molecular-weight:
    • 973.861

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality