Difference between revisions of "Crotonyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLC == * common-name: ** β-d-glucopyranose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-vfuothlcsa-n * mol...") |
(Created page with "Category:metabolite == Metabolite Crotonyl-ACPs == * common-name: ** a crotonyl-[acp] == Reaction(s) known to consume the compound == * RXN-9515 * RXN-9657 == Reac...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Crotonyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a crotonyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9515]] |
| − | * [[ | + | * [[RXN-9657]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[4.2.1.58-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a crotonyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Crotonyl-ACPs
- common-name:
- a crotonyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a crotonyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
