Difference between revisions of "CPD-22765"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-24-DINITROPHENYLGLUTATHIONE == * common-name: ** 2,4-dinitrophenyl-s-glutathione * smiles: ** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[...")
(Created page with "Category:metabolite == Metabolite CPD-22765 == == Reaction(s) known to consume the compound == * RXN21166 == Reaction(s) known to produce the compound == * [[RXN21165]...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-24-DINITROPHENYLGLUTATHIONE ==
+
== Metabolite CPD-22765 ==
* common-name:
 
** 2,4-dinitrophenyl-s-glutathione
 
* smiles:
 
** c(=o)([o-])cnc(=o)c(nc(=o)ccc([n+])c(=o)[o-])csc1(c=cc([n+]([o-])=o)=cc([n+]([o-])=o)=1)
 
* inchi-key:
 
** fxeukvkgtkddiq-uwvggrqhsa-m
 
* molecular-weight:
 
** 472.406
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GST-RXN]]
+
* [[RXN21166]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GST-RXN]]
+
* [[RXN21165]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,4-dinitrophenyl-s-glutathione}}
 
{{#set: inchi-key=inchikey=fxeukvkgtkddiq-uwvggrqhsa-m}}
 
{{#set: molecular-weight=472.406}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-22765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality