Difference between revisions of "LEUKOTRIENE-C4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Sugar-1-Phosphate == * common-name: ** a sugar 1-phosphate == Reaction(s) known to consume the compound == * 2.7.7.64-RXN == Reaction...")
(Created page with "Category:metabolite == Metabolite LEUKOTRIENE-C4 == * common-name: ** leukotriene-c4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc(...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Sugar-1-Phosphate ==
+
== Metabolite LEUKOTRIENE-C4 ==
 
* common-name:
 
* common-name:
** a sugar 1-phosphate
+
** leukotriene-c4
 +
* smiles:
 +
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
 +
* inchi-key:
 +
** gwnvdxqdilpjig-nxolixfesa-l
 +
* molecular-weight:
 +
** 623.76
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.64-RXN]]
+
* [[RXN66-336]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.64-RXN]]
+
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a sugar 1-phosphate}}
+
{{#set: common-name=leukotriene-c4}}
 +
{{#set: inchi-key=inchikey=gwnvdxqdilpjig-nxolixfesa-l}}
 +
{{#set: molecular-weight=623.76}}

Latest revision as of 11:17, 18 March 2021

Metabolite LEUKOTRIENE-C4

  • common-name:
    • leukotriene-c4
  • smiles:
    • cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
  • inchi-key:
    • gwnvdxqdilpjig-nxolixfesa-l
  • molecular-weight:
    • 623.76

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality