Difference between revisions of "4-AMINO-4-DEOXYCHORISMATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-277 == * common-name: ** 3-fumarylpyruvate * smiles: ** c([o-])(=o)c=cc(cc(c([o-])=o)=o)=o * inchi-key: ** azcflhzufanaor-owojbtedsa-...") |
(Created page with "Category:metabolite == Metabolite 4-AMINO-4-DEOXYCHORISMATE == * common-name: ** 4-amino-4-deoxychorismate * smiles: ** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1) * inch...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-AMINO-4-DEOXYCHORISMATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-amino-4-deoxychorismate |
* smiles: | * smiles: | ||
| − | ** c([o-])( | + | ** c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oiujhgolfkdbsu-htqzyqbosa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 224.193 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ADCLY-RXN]] |
| + | * [[PABASYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[ADCLY-RXN]] | ||
| + | * [[PABASYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-amino-4-deoxychorismate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oiujhgolfkdbsu-htqzyqbosa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=224.193}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite 4-AMINO-4-DEOXYCHORISMATE
- common-name:
- 4-amino-4-deoxychorismate
- smiles:
- c=c(c(=o)[o-])oc1(c([n+])c=cc(c([o-])=o)=c1)
- inchi-key:
- oiujhgolfkdbsu-htqzyqbosa-m
- molecular-weight:
- 224.193
