Difference between revisions of "CPD-16819"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRUVATE == * common-name: ** pyruvate * smiles: ** cc(=o)c(=o)[o-] * inchi-key: ** lctonwcanyupml-uhfffaoysa-m * molecular-weight: ** 87...")
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * smiles: ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) * inchi-key: ** wgnakzgusrvwrh-uhfffaoy...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRUVATE ==
+
== Metabolite CPD-16819 ==
 
* common-name:
 
* common-name:
** pyruvate
+
** 4-methylphenyl sulfate
 
* smiles:
 
* smiles:
** cc(=o)c(=o)[o-]
+
** cc1(c=cc(=cc=1)os(=o)(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** lctonwcanyupml-uhfffaoysa-m
+
** wgnakzgusrvwrh-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 87.055
+
** 187.19
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-15588]]
* [[1.5.1.11-RXN]]
 
* [[4.1.3.17-RXN]]
 
* [[4OH2OXOGLUTARALDOL-RXN]]
 
* [[ACETOLACTSYN-RXN]]
 
* [[ADCLY-RXN]]
 
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 
* [[ALANINE-DEHYDROGENASE-RXN]]
 
* [[ANTHRANSYN-RXN]]
 
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
 
* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
 
* [[DIHYDRODIPICSYN-RXN]]
 
* [[DLACTDEHYDROGNAD-RXN]]
 
* [[DXS-RXN]]
 
* [[L-LACTATE-DEHYDROGENASE-RXN]]
 
* [[PCr]]
 
* [[PYFLAVOXRE-RXN]]
 
* [[PYRUFLAVREDUCT-RXN]]
 
* [[PYRUVATE-CARBOXYLASE-RXN]]
 
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
* [[PYRUVDEH-RXN]]
 
* [[RXN-12074]]
 
* [[RXN-12583]]
 
* [[RXN-13698]]
 
* [[RXN-13990]]
 
* [[RXN-14037]]
 
* [[RXN-14146]]
 
* [[RXN-2464]]
 
* [[RXN0-1134]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-15588]]
* [[1.1.1.39-RXN]]
 
* [[23-DIMETHYLMALATE-LYASE-RXN]]
 
* [[4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN]]
 
* [[4.3.1.17-RXN]]
 
* [[4OH2OXOGLUTARALDOL-RXN]]
 
* [[ACYLPYRUVATE-HYDROLASE-RXN]]
 
* [[ADCLY-RXN]]
 
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 
* [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 
* [[ALANINE-DEHYDROGENASE-RXN]]
 
* [[ANTHRANSYN-RXN]]
 
* [[CYSTHIOCYS-RXN]]
 
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
 
* [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
 
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 
* [[DCYSDESULF-RXN]]
 
* [[DEHYDDEOXPHOSGALACT-ALDOL-RXN]]
 
* [[DSERDEAM-RXN]]
 
* [[GTPOP]]
 
* [[KDPGALDOL-RXN]]
 
* [[L-LACTATE-DEHYDROGENASE-RXN]]
 
* [[LCYSDESULF-RXN]]
 
* [[MALIC-NADP-RXN]]
 
* [[MERCAPYSTRANS-RXN]]
 
* [[OXALODECARB-RXN]]
 
* [[PCr]]
 
* [[PEPDEPHOS-RXN]]
 
* [[PYFLAVOXRE-RXN]]
 
* [[PYRUFLAVREDUCT-RXN]]
 
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 
* [[RXN-10445]]
 
* [[RXN-12074]]
 
* [[RXN-12729]]
 
* [[RXN-13698]]
 
* [[RXN-13990]]
 
* [[RXN-14037]]
 
* [[RXN-14117]]
 
* [[RXN-14146]]
 
* [[RXN-14192]]
 
* [[RXN-14207]]
 
* [[RXN-2464]]
 
* [[RXN-6763]]
 
* [[RXN-8672]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyruvate}}
+
{{#set: common-name=4-methylphenyl sulfate}}
{{#set: inchi-key=inchikey=lctonwcanyupml-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}}
{{#set: molecular-weight=87.055}}
+
{{#set: molecular-weight=187.19}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-16819

  • common-name:
    • 4-methylphenyl sulfate
  • smiles:
    • cc1(c=cc(=cc=1)os(=o)(=o)[o-])
  • inchi-key:
    • wgnakzgusrvwrh-uhfffaoysa-m
  • molecular-weight:
    • 187.19

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality