Difference between revisions of "Acetoacetyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17543 == * common-name: ** dapdiamide e * smiles: ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n)1) * inchi-key: ** bqmjfercspv...") |
(Created page with "Category:metabolite == Metabolite Acetoacetyl-ACPs == * common-name: ** an acetoacetyl-[acp] == Reaction(s) known to consume the compound == * RXN-9514 == Reaction(s)...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Acetoacetyl-ACPs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an acetoacetyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9514]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.3.1.180-RXN]] |
| + | * [[3-OXOACYL-ACP-SYNTH-BASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an acetoacetyl-[acp]}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Acetoacetyl-ACPs
- common-name:
- an acetoacetyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an acetoacetyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
