Difference between revisions of "Reduced-cytochromes-c551"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ASN == * common-name: ** l-asparagine * smiles: ** c(cc(c(=o)[o-])[n+])(n)=o * inchi-key: ** dcxyfedjocdnaf-reohclbhsa-n * molecular-weig...")
(Created page with "Category:metabolite == Metabolite Reduced-cytochromes-c551 == * common-name: ** a reduced cytochrome c551 == Reaction(s) known to consume the compound == * RXN-15838 =...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ASN ==
+
== Metabolite Reduced-cytochromes-c551 ==
 
* common-name:
 
* common-name:
** l-asparagine
+
** a reduced cytochrome c551
* smiles:
 
** c(cc(c(=o)[o-])[n+])(n)=o
 
* inchi-key:
 
** dcxyfedjocdnaf-reohclbhsa-n
 
* molecular-weight:
 
** 132.119
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPARAGHYD-RXN]]
+
* [[RXN-15838]]
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASNSYNA-RXN]]
+
* [[RXN-15838]]
* [[ASNSYNB-RXN]]
 
* [[RXN-12460]]
 
* [[RXN0-6982]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-asparagine}}
+
{{#set: common-name=a reduced cytochrome c551}}
{{#set: inchi-key=inchikey=dcxyfedjocdnaf-reohclbhsa-n}}
 
{{#set: molecular-weight=132.119}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Reduced-cytochromes-c551

  • common-name:
    • a reduced cytochrome c551

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality