Difference between revisions of "CPD-15362"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-903 == * common-name: ** n-ethylsuccinimide * smiles: ** ccn1(c(ccc1=o)=o) * inchi-key: ** ghazcvnukkztlg-uhfffaoysa-n * molecular-w...")
(Created page with "Category:metabolite == Metabolite CPD-15362 == * common-name: ** (2e,11z)-icosa-2,11-dienoyl-coa * smiles: ** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-903 ==
+
== Metabolite CPD-15362 ==
 
* common-name:
 
* common-name:
** n-ethylsuccinimide
+
** (2e,11z)-icosa-2,11-dienoyl-coa
 
* smiles:
 
* smiles:
** ccn1(c(ccc1=o)=o)
+
** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ghazcvnukkztlg-uhfffaoysa-n
+
** laeceuxzoonxdy-nwgwhigpsa-j
 
* molecular-weight:
 
* molecular-weight:
** 127.143
+
** 1053.99
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-5101]]
+
* [[RXN-14485]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-ethylsuccinimide}}
+
{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
{{#set: inchi-key=inchikey=ghazcvnukkztlg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
{{#set: molecular-weight=127.143}}
+
{{#set: molecular-weight=1053.99}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-15362

  • common-name:
    • (2e,11z)-icosa-2,11-dienoyl-coa
  • smiles:
    • ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • laeceuxzoonxdy-nwgwhigpsa-j
  • molecular-weight:
    • 1053.99

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality