Difference between revisions of "23S-RRNA-N2-METHYLGUANINE2445"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 == * common-name: ** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate * smiles: ** cccccc(=o)c=cc...")
(Created page with "Category:metabolite == Metabolite 23S-RRNA-N2-METHYLGUANINE2445 == * common-name: ** an n2-methylguanine2445 in 23s rrna == Reaction(s) known to consume the compound == ==...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 13E-11-ALPHA-HYDROXY-915-DIOXOPROST-1 ==
+
== Metabolite 23S-RRNA-N2-METHYLGUANINE2445 ==
 
* common-name:
 
* common-name:
** (13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate
+
** an n2-methylguanine2445 in 23s rrna
* smiles:
 
** cccccc(=o)c=cc1(c(o)cc(=o)c(ccccccc(=o)[o-])1)
 
* inchi-key:
 
** vxpbdcbtmskckz-xqhnhvhjsa-m
 
* molecular-weight:
 
** 351.462
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.197-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.197-RXN]]
+
* [[RXN-11574]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(13e)-11-α-hydroxy-9,15-dioxoprost-13-enoate}}
+
{{#set: common-name=an n2-methylguanine2445 in 23s rrna}}
{{#set: inchi-key=inchikey=vxpbdcbtmskckz-xqhnhvhjsa-m}}
 
{{#set: molecular-weight=351.462}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 23S-RRNA-N2-METHYLGUANINE2445

  • common-name:
    • an n2-methylguanine2445 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality