Difference between revisions of "CPD-207"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Ferrihemoglobins == * common-name: ** a ferrihemoglobin == Reaction(s) known to consume the compound == * RXN-11195 == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite CPD-207 == * common-name: ** phenylacetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-207 == |
* common-name: | * common-name: | ||
| − | ** | + | ** phenylacetyl-coa |
| + | * smiles: | ||
| + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** zigifdrjfzyeeq-cecatxlmsa-j | ||
| + | * molecular-weight: | ||
| + | ** 881.637 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10821]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phenylacetyl-coa}} |
| + | {{#set: inchi-key=inchikey=zigifdrjfzyeeq-cecatxlmsa-j}} | ||
| + | {{#set: molecular-weight=881.637}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-207
- common-name:
- phenylacetyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- zigifdrjfzyeeq-cecatxlmsa-j
- molecular-weight:
- 881.637
