Difference between revisions of "CPDQT-28"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOLE_PYRUVATE == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** rstklpzezyg...") |
(Created page with "Category:metabolite == Metabolite CPDQT-28 == * common-name: ** 7-(methylthio)-2-oxoheptanoate * smiles: ** cscccccc(=o)c([o-])=o * inchi-key: ** twaioppflzexco-uhfffaoysa...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-28 == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** 7-(methylthio)-2-oxoheptanoate |
* smiles: | * smiles: | ||
| − | ** c([o-]) | + | ** cscccccc(=o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** twaioppflzexco-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.249 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXNQT-4168]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=7-(methylthio)-2-oxoheptanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=twaioppflzexco-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.249}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPDQT-28
- common-name:
- 7-(methylthio)-2-oxoheptanoate
- smiles:
- cscccccc(=o)c([o-])=o
- inchi-key:
- twaioppflzexco-uhfffaoysa-m
- molecular-weight:
- 189.249
