Difference between revisions of "CPD-14485"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17046 == * common-name: ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))(nc(=...")
(Created page with "Category:metabolite == Metabolite CPD-14485 == * common-name: ** glycyrrhetaldehyde * smiles: ** cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc([ch]=o)(c)cc5...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17046 ==
+
== Metabolite CPD-14485 ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
+
** glycyrrhetaldehyde
 
* smiles:
 
* smiles:
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc([ch]=o)(c)cc5)c))))
 
* inchi-key:
 
* inchi-key:
** yjisldwviydioe-wgtgpsahsa-l
+
** otknpgbtqxvjnh-dfrazxlmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 842.848
+
** 454.692
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15681]]
+
* [[RXN-13494]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15680]]
+
* [[RXN-13493]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=glycyrrhetaldehyde}}
{{#set: inchi-key=inchikey=yjisldwviydioe-wgtgpsahsa-l}}
+
{{#set: inchi-key=inchikey=otknpgbtqxvjnh-dfrazxlmsa-n}}
{{#set: molecular-weight=842.848}}
+
{{#set: molecular-weight=454.692}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-14485

  • common-name:
    • glycyrrhetaldehyde
  • smiles:
    • cc4(c)(c3(ccc2(c)(c1(c)(ccc5([ch](c1=cc(c2c(c)3ccc(o)4)=o)cc([ch]=o)(c)cc5)c))))
  • inchi-key:
    • otknpgbtqxvjnh-dfrazxlmsa-n
  • molecular-weight:
    • 454.692

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality