Difference between revisions of "N-Ac-L-methionyl-L-glutaminyl-Protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-535 == * common-name: ** β-d-fructose 2,6-bisphosphate * smiles: ** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-] * inc...") |
(Created page with "Category:metabolite == Metabolite N-Ac-L-methionyl-L-glutaminyl-Protein == * common-name: ** an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein] == Reaction(s...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-Ac-L-methionyl-L-glutaminyl-Protein == |
* common-name: | * common-name: | ||
| − | ** & | + | ** an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17893]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein]}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite N-Ac-L-methionyl-L-glutaminyl-Protein
- common-name:
- an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal nα-acetyl-l-methionyl-l-glutaminyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
