Difference between revisions of "CPD-8974"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11529 == * common-name: ** (+)-7-epi-jasmonoyl-coa * smiles: ** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(...")
(Created page with "Category:metabolite == Metabolite CPD-8974 == * common-name: ** dimethylthiophosphate * smiles: ** cop([o-])(=s)oc * inchi-key: ** wwjjvkaeqggyhj-uhfffaoysa-m * molecular-...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11529 ==
+
== Metabolite CPD-8974 ==
 
* common-name:
 
* common-name:
** (+)-7-epi-jasmonoyl-coa
+
** dimethylthiophosphate
 
* smiles:
 
* smiles:
** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** cop([o-])(=s)oc
 
* inchi-key:
 
* inchi-key:
** wqkkcppndksaiu-cbgydujusa-j
+
** wwjjvkaeqggyhj-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 955.76
+
** 141.101
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10708]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10701]]
+
* [[RXN-8743]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-7-epi-jasmonoyl-coa}}
+
{{#set: common-name=dimethylthiophosphate}}
{{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}}
+
{{#set: inchi-key=inchikey=wwjjvkaeqggyhj-uhfffaoysa-m}}
{{#set: molecular-weight=955.76}}
+
{{#set: molecular-weight=141.101}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-8974

  • common-name:
    • dimethylthiophosphate
  • smiles:
    • cop([o-])(=s)oc
  • inchi-key:
    • wwjjvkaeqggyhj-uhfffaoysa-m
  • molecular-weight:
    • 141.101

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality