Difference between revisions of "CPD-8132"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8076 == * common-name: ** 1-18:3-2-16:1-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
(Created page with "Category:metabolite == Metabolite CPD-8132 == * common-name: ** thiophenol * smiles: ** c1(c=cc(=cc=1)[s-]) * inchi-key: ** rmvrsndyefqclf-uhfffaoysa-m * molecular-weight:...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8076 ==
+
== Metabolite CPD-8132 ==
 
* common-name:
 
* common-name:
** 1-18:3-2-16:1-monogalactosyldiacylglycerol
+
** thiophenol
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccccccccc)=o)=o
+
** c1(c=cc(=cc=1)[s-])
 
* inchi-key:
 
* inchi-key:
** syspljxkzrpipm-lwnbrhqxsa-n
+
** rmvrsndyefqclf-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 751.052
+
** 109.165
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13726]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8297]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-16:1-monogalactosyldiacylglycerol}}
+
{{#set: common-name=thiophenol}}
{{#set: inchi-key=inchikey=syspljxkzrpipm-lwnbrhqxsa-n}}
+
{{#set: inchi-key=inchikey=rmvrsndyefqclf-uhfffaoysa-m}}
{{#set: molecular-weight=751.052}}
+
{{#set: molecular-weight=109.165}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-8132

  • common-name:
    • thiophenol
  • smiles:
    • c1(c=cc(=cc=1)[s-])
  • inchi-key:
    • rmvrsndyefqclf-uhfffaoysa-m
  • molecular-weight:
    • 109.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality