Difference between revisions of "DOLICHOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15280 == * common-name: ** hercynine * smiles: ** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-] * inchi-key: ** gppytcrvkhuljh-qmmmgpobsa-n * m...")
(Created page with "Category:metabolite == Metabolite DOLICHOL == * common-name: ** a dolichol == Reaction(s) known to consume the compound == * DOLICHOL-KINASE-RXN == Reaction(s) known t...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15280 ==
+
== Metabolite DOLICHOL ==
 
* common-name:
 
* common-name:
** hercynine
+
** a dolichol
* smiles:
 
** c[n+](c)(c)c(cc1(=cnc=n1))c(=o)[o-]
 
* inchi-key:
 
** gppytcrvkhuljh-qmmmgpobsa-n
 
* molecular-weight:
 
** 197.236
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14430]]
+
* [[DOLICHOL-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9971]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=hercynine}}
+
{{#set: common-name=a dolichol}}
{{#set: inchi-key=inchikey=gppytcrvkhuljh-qmmmgpobsa-n}}
 
{{#set: molecular-weight=197.236}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite DOLICHOL

  • common-name:
    • a dolichol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality