Difference between revisions of "CPD-14766"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11520 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc...")
(Created page with "Category:metabolite == Metabolite CPD-14766 == * common-name: ** 2-hydroxyhexadecanal * smiles: ** ccccccccccccccc(o)[ch]=o * inchi-key: ** bkbdvqvdrvgxkt-uhfffaoysa-n * m...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11520 ==
+
== Metabolite CPD-14766 ==
 
* common-name:
 
* common-name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
+
** 2-hydroxyhexadecanal
 
* smiles:
 
* smiles:
** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
+
** ccccccccccccccc(o)[ch]=o
 
* inchi-key:
 
* inchi-key:
** yyccmactoajggw-ozvhgmpnsa-j
+
** bkbdvqvdrvgxkt-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 1053.904
+
** 256.428
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10699]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10698]]
+
* [[RXN-13729]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa}}
+
{{#set: common-name=2-hydroxyhexadecanal}}
{{#set: inchi-key=inchikey=yyccmactoajggw-ozvhgmpnsa-j}}
+
{{#set: inchi-key=inchikey=bkbdvqvdrvgxkt-uhfffaoysa-n}}
{{#set: molecular-weight=1053.904}}
+
{{#set: molecular-weight=256.428}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-14766

  • common-name:
    • 2-hydroxyhexadecanal
  • smiles:
    • ccccccccccccccc(o)[ch]=o
  • inchi-key:
    • bkbdvqvdrvgxkt-uhfffaoysa-n
  • molecular-weight:
    • 256.428

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality