Difference between revisions of "DEAMIDO-NAD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL == * common-name: ** rnase ii substrate with no poly-a tail == Reaction(s) known to consume the co...") |
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * smiles: ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEAMIDO-NAD == |
* common-name: | * common-name: | ||
| − | ** | + | ** nicotinate adenine dinucleotide |
| + | * smiles: | ||
| + | ** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o) | ||
| + | * inchi-key: | ||
| + | ** senpvezbrzqvst-hisdbwnosa-l | ||
| + | * molecular-weight: | ||
| + | ** 662.399 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[NAD-SYNTH-GLN-RXN]] | ||
| + | * [[NAD-SYNTH-NH3-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[NICONUCADENYLYLTRAN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nicotinate adenine dinucleotide}} |
| + | {{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}} | ||
| + | {{#set: molecular-weight=662.399}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DEAMIDO-NAD
- common-name:
- nicotinate adenine dinucleotide
- smiles:
- c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
- inchi-key:
- senpvezbrzqvst-hisdbwnosa-l
- molecular-weight:
- 662.399
