Difference between revisions of "23S-rRNA-uridine955-2504-2580"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** 5',5'''-diadenosine tetraphosphate * smiles: ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine955-2504-2580 == * common-name: ** uridine955/2504/2580 in 23s rrna == Reaction(s) known to consume the compound == * R...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENOSYL-P4 ==
+
== Metabolite 23S-rRNA-uridine955-2504-2580 ==
 
* common-name:
 
* common-name:
** 5',5'''-diadenosine tetraphosphate
+
** uridine955/2504/2580 in 23s rrna
* smiles:
 
** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
 
* inchi-key:
 
** yoahknvsncmzgq-xpwfqurosa-j
 
* molecular-weight:
 
** 832.36
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.1.41-RXN]]
+
* [[RXN-11838]]
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5',5'''-diadenosine tetraphosphate}}
+
{{#set: common-name=uridine955/2504/2580 in 23s rrna}}
{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}
 
{{#set: molecular-weight=832.36}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite 23S-rRNA-uridine955-2504-2580

  • common-name:
    • uridine955/2504/2580 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality