Difference between revisions of "LYS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite UDP-L-ARABINOSE == * common-name: ** udp-l-arabinose == Reaction(s) known to consume the compound == * UA4E == Reaction(s) known to p...") |
(Created page with "Category:metabolite == Metabolite LYS == * common-name: ** l-lysine * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: ** kdxkernsbixsrk-yfkpbyrvsa-o * molecular-weight:...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite LYS == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-lysine |
| + | * smiles: | ||
| + | ** c([n+])cccc([n+])c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** kdxkernsbixsrk-yfkpbyrvsa-o | ||
| + | * molecular-weight: | ||
| + | ** 147.197 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[LYSINE--TRNA-LIGASE-RXN]] |
| + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] | ||
| + | * [[RXN-1961]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIAMINOPIMDECARB-RXN]] |
| − | * [[ | + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-lysine}} |
| + | {{#set: inchi-key=inchikey=kdxkernsbixsrk-yfkpbyrvsa-o}} | ||
| + | {{#set: molecular-weight=147.197}} | ||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite LYS
- common-name:
- l-lysine
- smiles:
- c([n+])cccc([n+])c([o-])=o
- inchi-key:
- kdxkernsbixsrk-yfkpbyrvsa-o
- molecular-weight:
- 147.197
