Difference between revisions of "CPD-9858"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...") |
(Created page with "Category:metabolite == Metabolite CPD-9858 == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-9858 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wegxyvfdoluulo-tuumqracsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 616.966 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-9227]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=616.966}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-9858
- common-name:
- 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
- inchi-key:
- wegxyvfdoluulo-tuumqracsa-n
- molecular-weight:
- 616.966