Difference between revisions of "CPD-8165"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-XYLULOSE == * common-name: ** d-xylulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi-key: ** zaqjhhrnxzubte-wujlrwpwsa-n * molecular-weigh...") |
(Created page with "Category:metabolite == Metabolite CPD-8165 == * common-name: ** 1-18:2-2-18:2-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8165 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:2-2-18:2-monogalactosyldiacylglycerol |
* smiles: | * smiles: | ||
| − | ** c(o)c(o)c(o) | + | ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** broompuvdptgeg-rhnbirjrsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 779.105 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8366]] |
| + | * [[RXN-8367]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:2-2-18:2-monogalactosyldiacylglycerol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=broompuvdptgeg-rhnbirjrsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=779.105}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-8165
- common-name:
- 1-18:2-2-18:2-monogalactosyldiacylglycerol
- smiles:
- cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
- inchi-key:
- broompuvdptgeg-rhnbirjrsa-n
- molecular-weight:
- 779.105
