Difference between revisions of "CPD-253"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-]...") |
(Created page with "Category:metabolite == Metabolite CPD-253 == * common-name: ** 4,5-seco-dopa * smiles: ** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o * inchi-key: ** fnegjfdtwwxqes-qtwonpp...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-253 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4,5-seco-dopa |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fnegjfdtwwxqes-qtwonppnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 228.181 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-8460]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4,5-seco-dopa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fnegjfdtwwxqes-qtwonppnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=228.181}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-253
- common-name:
- 4,5-seco-dopa
- smiles:
- c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o
- inchi-key:
- fnegjfdtwwxqes-qtwonppnsa-m
- molecular-weight:
- 228.181
