Difference between revisions of "COPROPORPHYRIN III"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...")
(Created page with "Category:metabolite == Metabolite COPROPORPHYRIN_III == * common-name: ** coproporphyrin iii * smiles: ** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite URIDINE ==
+
== Metabolite COPROPORPHYRIN_III ==
 
* common-name:
 
* common-name:
** uridine
+
** coproporphyrin iii
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
+
** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
 
* inchi-key:
 
* inchi-key:
** drtqhjpvmgbucf-xvfcmesisa-n
+
** jwfcywsmnrlxlx-ujjxfscmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 244.204
+
** 650.687
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AUPT]]
+
* [[RXN-17518]]
* [[DATUP]]
 
* [[DCTUP]]
 
* [[DGTUP]]
 
* [[DTTUP]]
 
* [[DUTUP]]
 
* [[GTUP]]
 
* [[ITUP]]
 
* [[URIDINE-NUCLEOSIDASE-RXN]]
 
* [[URIDINEKIN-RXN]]
 
* [[URKI-RXN]]
 
* [[URPHOS-RXN]]
 
* [[UTUP]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CYTIDEAM2-RXN]]
+
* [[RXN-17517]]
* [[RXN-14025]]
 
* [[UMPP]]
 
* [[URPHOS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=uridine}}
+
{{#set: common-name=coproporphyrin iii}}
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
+
{{#set: inchi-key=inchikey=jwfcywsmnrlxlx-ujjxfscmsa-j}}
{{#set: molecular-weight=244.204}}
+
{{#set: molecular-weight=650.687}}

Latest revision as of 11:15, 18 March 2021

Metabolite COPROPORPHYRIN_III

  • common-name:
    • coproporphyrin iii
  • smiles:
    • cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
  • inchi-key:
    • jwfcywsmnrlxlx-ujjxfscmsa-j
  • molecular-weight:
    • 650.687

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality