Difference between revisions of "Pre-tRNA-5-prime-half-molecules"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...")
(Created page with "Category:metabolite == Metabolite Pre-tRNA-5-prime-half-molecules == * common-name: ** a 5'-half-trna molecule with a 2',3'-cyclic phosphate end == Reaction(s) known to co...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GTP ==
+
== Metabolite Pre-tRNA-5-prime-half-molecules ==
 
* common-name:
 
* common-name:
** gtp
+
** a 5'-half-trna molecule with a 2',3'-cyclic phosphate end
* smiles:
 
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
** xkmlyualxhknft-uuokfmhzsa-j
 
* molecular-weight:
 
** 519.151
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 
* [[FE2GTPabc]]
 
* [[GTCY]]
 
* [[GTP-CYCLOHYDRO-I-RXN]]
 
* [[GTP-CYCLOHYDRO-II-RXN]]
 
* [[GTPPYPHOSKIN-RXN]]
 
* [[GTUP]]
 
* [[GUANYLCYC-RXN]]
 
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 
* [[NTDP]]
 
* [[RXN-12502]]
 
* [[RXN-12504]]
 
* [[RXN-14140]]
 
* [[RXN-14201]]
 
* [[RXN-15713]]
 
* [[RXN-17921]]
 
* [[RXN-8340]]
 
* [[RXN-8988]]
 
* [[RXN0-5462]]
 
* [[RXN0-746]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
* [[URKI-RXN]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.1.17-RXN]]
+
* [[3.1.27.9-RXN]]
* [[ATGD]]
 
* [[GDPKIN-RXN]]
 
* [[GTPOP]]
 
* [[RXN-14117]]
 
* [[RXN0-6427]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gtp}}
+
{{#set: common-name=a 5'-half-trna molecule with a 2',3'-cyclic phosphate end}}
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}
 
{{#set: molecular-weight=519.151}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Pre-tRNA-5-prime-half-molecules

  • common-name:
    • a 5'-half-trna molecule with a 2',3'-cyclic phosphate end

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality