Difference between revisions of "CYTOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-401 == * common-name: ** anserine * smiles: ** cn1(c=nc=c1cc(nc(cc[n+])=o)c([o-])=o) * inchi-key: ** myyiahxivfadcu-qmmmgpobsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite CYTOSINE == * common-name: ** cytosine * smiles: ** c1(nc(=o)n=c(n)c=1) * inchi-key: ** optasplrgrrnap-uhfffaoysa-n * molecular-weight: *...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CYTOSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** cytosine |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc(=o)n=c(n)c=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** optasplrgrrnap-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 111.103 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-361]] |
| + | * [[RXN0-985]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cytosine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=optasplrgrrnap-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=111.103}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CYTOSINE
- common-name:
- cytosine
- smiles:
- c1(nc(=o)n=c(n)c=1)
- inchi-key:
- optasplrgrrnap-uhfffaoysa-n
- molecular-weight:
- 111.103
