Difference between revisions of "Primary-Amines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DOPAMINE == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inchi-key: ** vyfyytllbukuhu-uhfffaoysa-o * molecular-w...") |
(Created page with "Category:metabolite == Metabolite Primary-Amines == * common-name: ** a primary amine == Reaction(s) known to consume the compound == * ARYLAMINE-SULFOTRANSFERASE-RXN...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Primary-Amines == |
* common-name: | * common-name: | ||
− | ** | + | ** a primary amine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ARYLAMINE-SULFOTRANSFERASE-RXN]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ARYLAMINE-SULFOTRANSFERASE-RXN]] |
+ | * [[RXN-9598]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a primary amine}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Primary-Amines
- common-name:
- a primary amine