Difference between revisions of "Adenine-34-in-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-61 == * common-name: ** (2r,3s)-2,3-dimethylmalate * smiles: ** cc(c(=o)[o-])c(c)(o)c(=o)[o-] * inchi-key: ** wtiiulqjlzehgz-cvyqjglw...") |
(Created page with "Category:metabolite == Metabolite Adenine-34-in-tRNAs == * common-name: ** an adenine34 in trna == Reaction(s) known to consume the compound == * RXN-13997 == Reaction...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Adenine-34-in-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** an adenine34 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13997]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-13997]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an adenine34 in trna}} |
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Adenine-34-in-tRNAs
- common-name:
- an adenine34 in trna