Difference between revisions of "Adenine-34-in-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-61 == * common-name: ** (2r,3s)-2,3-dimethylmalate * smiles: ** cc(c(=o)[o-])c(c)(o)c(=o)[o-] * inchi-key: ** wtiiulqjlzehgz-cvyqjglw...")
(Created page with "Category:metabolite == Metabolite Adenine-34-in-tRNAs == * common-name: ** an adenine34 in trna == Reaction(s) known to consume the compound == * RXN-13997 == Reaction...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-61 ==
+
== Metabolite Adenine-34-in-tRNAs ==
 
* common-name:
 
* common-name:
** (2r,3s)-2,3-dimethylmalate
+
** an adenine34 in trna
* smiles:
 
** cc(c(=o)[o-])c(c)(o)c(=o)[o-]
 
* inchi-key:
 
** wtiiulqjlzehgz-cvyqjglwsa-l
 
* molecular-weight:
 
** 160.126
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[23-DIMETHYLMALATE-LYASE-RXN]]
+
* [[RXN-13997]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13997]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2r,3s)-2,3-dimethylmalate}}
+
{{#set: common-name=an adenine34 in trna}}
{{#set: inchi-key=inchikey=wtiiulqjlzehgz-cvyqjglwsa-l}}
 
{{#set: molecular-weight=160.126}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Adenine-34-in-tRNAs

  • common-name:
    • an adenine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality