Difference between revisions of "CPD-19163"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * smiles: ** c(o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-key: ** mtvwfvdwrvydor-qmmmgpob...") |
(Created page with "Category:metabolite == Metabolite CPD-19163 == * common-name: ** (2e,11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-19163 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2e,11z)-octadecenoyl-coa |
* smiles: | * smiles: | ||
− | ** c(o)c(o) | + | ** ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** opmpwwfmnywbgf-pkybcsrxsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1025.937 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17785]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17784]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2e,11z)-octadecenoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=opmpwwfmnywbgf-pkybcsrxsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1025.937}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-19163
- common-name:
- (2e,11z)-octadecenoyl-coa
- smiles:
- ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- opmpwwfmnywbgf-pkybcsrxsa-j
- molecular-weight:
- 1025.937