Difference between revisions of "Glycols"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE == * common-name: ** 2-dehydro-3-deoxy-d-gluconate 6-phosphate * smiles: ** c(=o)([o-])c(=o)cc(o)c(o)cop([o-...")
(Created page with "Category:metabolite == Metabolite glycols == * common-name: ** a glycol == Reaction(s) known to consume the compound == * 3.3.2.10-RXN == Reaction(s) known to produce...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE ==
+
== Metabolite glycols ==
 
* common-name:
 
* common-name:
** 2-dehydro-3-deoxy-d-gluconate 6-phosphate
+
** a glycol
* smiles:
 
** c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-]
 
* inchi-key:
 
** ovprppovaxrced-wvzvxsggsa-k
 
* molecular-weight:
 
** 255.098
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[KDPGALDOL-RXN]]
+
* [[3.3.2.10-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PGLUCONDEHYDRAT-RXN]]
+
* [[3.3.2.10-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-dehydro-3-deoxy-d-gluconate 6-phosphate}}
+
{{#set: common-name=a glycol}}
{{#set: inchi-key=inchikey=ovprppovaxrced-wvzvxsggsa-k}}
 
{{#set: molecular-weight=255.098}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite glycols

  • common-name:
    • a glycol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality