Difference between revisions of "2-HYDROXYPHYTANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLC-D-LACTONE == * common-name: ** d-glucono-1,5-lactone * smiles: ** c(o)c1(oc(c(c(c1o)o)o)=o) * inchi-key: ** phoqvhqstubqqk-sqougzdysa...")
(Created page with "Category:metabolite == Metabolite 2-HYDROXYPHYTANOYL-COA == * common-name: ** 2-hydroxyphytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLC-D-LACTONE ==
+
== Metabolite 2-HYDROXYPHYTANOYL-COA ==
 
* common-name:
 
* common-name:
** d-glucono-1,5-lactone
+
** 2-hydroxyphytanoyl-coa
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(c(c1o)o)o)=o)
+
** cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** phoqvhqstubqqk-sqougzdysa-n
+
** wnvfjmypvbolkv-ylnukallsa-j
 
* molecular-weight:
 
* molecular-weight:
** 178.141
+
** 1074.021
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUCONOLACT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.14.11.18-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glucono-1,5-lactone}}
+
{{#set: common-name=2-hydroxyphytanoyl-coa}}
{{#set: inchi-key=inchikey=phoqvhqstubqqk-sqougzdysa-n}}
+
{{#set: inchi-key=inchikey=wnvfjmypvbolkv-ylnukallsa-j}}
{{#set: molecular-weight=178.141}}
+
{{#set: molecular-weight=1074.021}}

Latest revision as of 11:15, 18 March 2021

Metabolite 2-HYDROXYPHYTANOYL-COA

  • common-name:
    • 2-hydroxyphytanoyl-coa
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)c(o)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • wnvfjmypvbolkv-ylnukallsa-j
  • molecular-weight:
    • 1074.021

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality