Difference between revisions of "Initiation-tRNAmet"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE == * common-name: ** 7,8-dihydrofolate monoglutamate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=...")
(Created page with "Category:metabolite == Metabolite Initiation-tRNAmet == * common-name: ** initiator trnamet == Reaction(s) known to consume the compound == * RXN-16165 == Reaction(s)...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDROFOLATE ==
+
== Metabolite Initiation-tRNAmet ==
 
* common-name:
 
* common-name:
** 7,8-dihydrofolate monoglutamate
+
** initiator trnamet
* smiles:
 
** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
 
* inchi-key:
 
** ozrnssudzolusn-lbprgkrzsa-l
 
* molecular-weight:
 
** 441.402
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DHFR2i]]
+
* [[RXN-16165]]
* [[DHFRi]]
 
* [[MDUMT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DHFOR]]
 
* [[DIHYDROFOLATESYNTH-RXN]]
 
* [[FOLR2]]
 
* [[MDUMT]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydrofolate monoglutamate}}
+
{{#set: common-name=initiator trnamet}}
{{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}}
 
{{#set: molecular-weight=441.402}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Initiation-tRNAmet

  • common-name:
    • initiator trnamet

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality